10-dehydrogingerdione
| Name(s) | 10-dehydrogingerdione |
|---|---|
| Scientific name(s) | |
| Formula | C21H30O4 |
| Molecular mass | 346.5 |
| IUPAC name | (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradeca-1,3-dien-5-one |
| INCHI | Not available |
| SMILE | CCCCCCCCCC(=O)\C=C(/O)\C=C/C1=CC(OC)=C(O)C=C1 |
| CAS ID | 82206-04-0 |
| PubChem ID | 5316450 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | 10-dehydrogingerdione is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. 10-dehydrogingerdione is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 10-dehydrogingerdione can be found in ginger, which makes 10-dehydrogingerdione a potential biomarker for the consumption of this food product. |
|---|