zonarene
| Name(s) | zonarene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.357 |
| IUPAC name | (1s)-1,6-dimethyl-4-(propan-2-yl)-1,2,3,7,8,8a-hexahydronaphthalene |
| INCHI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,12,14H,5-8H2,1-4H3/t12-,14?/m0/s1 |
| SMILE | CC(C)C1=C2C=C(C)CCC2[C@@H](C)CC1 |
| CAS ID | 41929-05-9 |
| PubChem ID | 6428488 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Zonarene is a member of the class of compounds known as sesquiterpenoids. Sesquiterpenoids are terpenes with three consecutive isoprene units. Zonarene can be found in allspice, cloves, and ginger, which makes zonarene a potential biomarker for the consumption of these food products. |
|---|