dehydrogingerdione
| Name(s) | dehydrogingerdione |
|---|---|
| Scientific name(s) | |
| Formula | C17H22O4 |
| Molecular mass | 290.3542 |
| IUPAC name | (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,3-dien-5-one |
| INCHI | InChI=1S/C17H22O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h7-12,19-20H,3-6H2,1-2H3/b9-7-,15-12- |
| SMILE | CCCCCC(=O)\C=C(/O)\C=C/C1=CC(OC)=C(O)C=C1 |
| CAS ID | 189128-20-9 |
| PubChem ID | 5316449 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Dehydrogingerdione is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. Dehydrogingerdione is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Dehydrogingerdione can be found in ginger, which makes dehydrogingerdione a potential biomarker for the consumption of this food product. |
|---|