| Name(s) | 4-gingerol; [4]-gingerol |
|---|---|
| Scientific name(s) | 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)octan-3-one; chembl3883439; 3-octanone, 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-; schembl20668437; dtxsid70415723; chebi:156171 |
| Formula | C15H22O4 |
| Molecular mass | 266.33 |
| IUPAC name | 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)octan-3-one |
| INCHI | InChI=1S/C15H22O4/c1-3-4-12(16)10-13(17)7-5-11-6-8-14(18)15(9-11)19-2/h6,8-9,12,16,18H,3-5,7,10H2,1-2H3/t12-/m0/s1 |
| SMILE | CCC[C@H](O)CC(=O)CCC1=CC(OC)=C(O)C=C1 |
| CAS ID | 77398-90-4; 41743-68-4 |
| PubChem ID | 5317596 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | [4]-gingerol is a member of the class of compounds known as gingerols. Gingerols are compounds containing a gingerol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by a 5-hydroxy-alkane-3-one. [4]-gingerol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [4]-gingerol can be found in ginger, which makes [4]-gingerol a potential biomarker for the consumption of this food product. |
|---|