methyl diacetoxy-6-gingerdiol; 3'-methoxy-[6]-gingerdiol 3,5-diacetate
| Name(s) | methyl diacetoxy-6-gingerdiol; 3'-methoxy-[6]-gingerdiol 3,5-diacetate |
|---|---|
| Scientific name(s) | |
| Formula | C22H34O6 |
| Molecular mass | 394.508 |
| IUPAC name | 3-(acetyloxy)-1-(3,4-dimethoxyphenyl)decan-5-yl acetate |
| INCHI | InChI=1S/C22H34O6/c1-6-7-8-9-19(27-16(2)23)15-20(28-17(3)24)12-10-18-11-13-21(25-4)22(14-18)26-5/h11,13-14,19-20H,6-10,12,15H2,1-5H3 |
| SMILE | CCCCCC(CC(CCC1=CC(OC)=C(OC)C=C1)OC(C)=O)OC(C)=O |
| CAS ID | 143519-18-0 |
| PubChem ID | 5319662 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of ginger (Zingiber officinale) rhizomes. 3'-Methoxy-[6]-Gingerdiol 3,5-diacetate is found in herbs and spices and ginger. |
|---|