melatonin
| Name(s) | melatonin |
|---|---|
| Scientific name(s) | |
| Formula | C13H16N2O2 |
| Molecular mass | 232.283 |
| IUPAC name | n-[2-(5-methoxy-1h-indol-3-yl)ethyl]acetamide |
| INCHI | InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
| SMILE | COC1=CC=C2NC=C(CCNC(C)=O)C2=C1 |
| CAS ID | 73-31-4 |
| PubChem ID | 896 |
| DrugBank ID | DB01065 |
| CHEBI ID | 16796 |
| Description | Melatonin, also known chemically as N-acetyl-5-methoxytryptamine, is a naturally occurring compound found in animals, plants and microbes. In animals, circulating levels of the hormone melatonin vary in a daily cycle, thereby allowing the entrainment of the circadian rhythms of several biological functions. |
|---|