trans-isoeugenol; isoeugenol
| Name(s) | trans-isoeugenol; isoeugenol |
|---|---|
| Scientific name(s) | isoeugenol; 97-54-1; (e)-isoeugenol; 2-methoxy-4-propenylphenol; 4-propenylguaiacol; 2-methoxy-4-(prop-1-en-1-yl)phenol; 5932-68-3; trans-isoeugenol |
| Formula | C10H12O2 |
| Molecular mass | 164.204 |
| IUPAC name | 2-methoxy-4-propenyl phenol; 2-methoxy-4-[(e)-prop-1-enyl]phenol |
| INCHI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3-7,11H,1-2H3/b4-3+ |
| SMILE | COC1=CC(\C=C\C)=CC=C1O |
| CAS ID | 97-54-1 |
| PubChem ID | 853433 |
| DrugBank ID | Not available |
| CHEBI ID | 18224 |
| Description | It is used in flavourings. Occurs in ylang-ylang and other essential oils. Isoeugenol is found in many foods, some of which are celeriac, spearmint, kale, and pepper (c. baccatum). |
|---|