beta-selinene; eudesma-4(14),11-diene; β-selinene
| Name(s) | beta-selinene; eudesma-4(14),11-diene; β-selinene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.3511 |
| IUPAC name | 4a-methyl-1-methylidene-7-(prop-1-en-2-yl)-decahydronaphthalene |
| INCHI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3 |
| SMILE | CC(=C)C1CCC2(C)CCCC(=C)C2C1 |
| CAS ID | 17066-67-0 |
| PubChem ID | 442393 |
| DrugBank ID | Not available |
| CHEBI ID | 10443 |
| Description | Constituent of celery oiland is) also from Cyperus rotundus (nutgrass) and Humulus lupulus (hops). beta-Selinene is found in many foods, some of which are safflower, star anise, chinese cinnamon, and allspice. |
|---|