| Name(s) | diacetoxy-4-gingerdiol; 1-(4-hydroxy-3-methoxyphenyl)-3,5-diacetoxyoctane |
|---|---|
| Scientific name(s) | |
| Formula | C19H28O6 |
| Molecular mass | 352.427 |
| IUPAC name | 5-(acetyloxy)-1-(4-hydroxy-3-methoxyphenyl)octan-3-yl acetate |
| INCHI | InChI=1S/C19H28O6/c1-5-6-16(24-13(2)20)12-17(25-14(3)21)9-7-15-8-10-18(22)19(11-15)23-4/h8,10-11,16-17,22H,5-7,9,12H2,1-4H3 |
| SMILE | CCCC(CC(CCC1=CC(OC)=C(O)C=C1)OC(C)=O)OC(C)=O |
| CAS ID | Not available |
| PubChem ID | 5318274 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | [4]-gingerdiol 3,5-diacetate is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. [4]-gingerdiol 3,5-diacetate is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [4]-gingerdiol 3,5-diacetate can be found in herbs and spices, which makes [4]-gingerdiol 3,5-diacetate a potential biomarker for the consumption of this food product. |
|---|