alpha-terpinolene; terpinolene; p-mentha-1,4(8)-diene; cyclohexene, 1-methyl-4-(1-methylethylidene)-; terpinolen
| Name(s) | alpha-terpinolene; terpinolene; p-mentha-1,4(8)-diene; cyclohexene, 1-methyl-4-(1-methylethylidene)-; terpinolen |
|---|---|
| Scientific name(s) | 586-62-9; isoterpinene; terpinolen; alpha-terpinolene; p-mentha-1,4(8)-diene; 1,4(8)-p-menthadiene; 4-isopropylidene-1-methylcyclohexene; p-mentha-1,4(8)-diene；isoterpinene |
| Formula | C10H16 |
| Molecular mass | 136.238 |
| IUPAC name | 1-methyl-4-propan-2-ylidenecyclohexene; p-mentha-1,4(8)-diene |
| INCHI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4H,5-7H2,1-3H3 |
| SMILE | CC(C)=C1CCC(C)=CC1 |
| CAS ID | 586-62-9 |
| PubChem ID | 11463 |
| DrugBank ID | Not available |
| CHEBI ID | 9457 |
| Description | Constituent of many essential oils e.g. Citrus, Mentha, Juniperus, Myristica subspecies Parsnip oil (Pastinaca sativa) is a major source (40-70%). Flavouring ingredient. Terpinolene is found in many foods, some of which are coriander, ceylon cinnamon, pine nut, and caraway. |
|---|