neryl acetate; nerol acetate; cis-geranyl acetate; 2,6-octadien-1-ol, 3,7-dimethyl-, acetate, (z)-
| Name(s) | neryl acetate; nerol acetate; cis-geranyl acetate; 2,6-octadien-1-ol, 3,7-dimethyl-, acetate, (z)- |
|---|---|
| Scientific name(s) | |
| Formula | C12H20O2 |
| Molecular mass | 196.29 |
| IUPAC name | (2z)-3,7-dimethylocta-2,6-dien-1-yl acetate |
| INCHI | InChI=1S/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8- |
| SMILE | CC(C)=CCC\C(C)=C/COC(C)=O |
| CAS ID | 141-12-8; 105-87-3 |
| PubChem ID | 1549025 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Found in citrus, kumquat and pummelo peel oils, ginger, cardamon, clary sage, myrtle leaf and myrtle berries. Flavouring agent |
|---|