alpha-guaiene; α-guaiene; guaia-1(5),11-diene
| Name(s) | alpha-guaiene; α-guaiene; guaia-1(5),11-diene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.3511 |
| IUPAC name | 1,4-dimethyl-7-(prop-1-en-2-yl)-1,2,3,4,5,6,7,8-octahydroazulene |
| INCHI | InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-13H,1,5-9H2,2-4H3 |
| SMILE | CC1CCC2=C1CC(CCC2C)C(C)=C |
| CAS ID | 654486; 3691-12-1 |
| PubChem ID | 5317844 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of guaiac wood oil (Bulnesia sarmienti). alpha-Guaiene is found in many foods, some of which are herbs and spices, sweet basil, burdock, and pepper (spice). |
|---|