cis-geraniol; nerol
| Name(s) | cis-geraniol; nerol |
|---|---|
| Scientific name(s) | |
| Formula | C10H18O |
| Molecular mass | 154.253 |
| IUPAC name | (z)-3,7-dimethyl-2,6-octadien-1-ol |
| INCHI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7- |
| SMILE | CC(C)=CCC\C(C)=C/CO |
| CAS ID | 106-25-2 |
| PubChem ID | 643820 |
| DrugBank ID | Not available |
| CHEBI ID | 29452 |
| Description | Constituent of many essential oils including neroli and bergamot oils. In essential oils it is a minor component always accompanied by geraniol. Flavouring agent_x000D_ _x000D_ Nerol is a monoterpene found in many essential oils such as lemongrass. It is the isomer of geraniol. |
|---|