delta-elemene; δ-elemene
| Name(s) | delta-elemene; δ-elemene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.3511 |
| IUPAC name | 4-ethenyl-4-methyl-3-(prop-1-en-2-yl)-1-(propan-2-yl)cyclohex-1-ene |
| INCHI | InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,10-11,14H,1,4,8-9H2,2-3,5-6H3 |
| SMILE | CC(C)C1=CC(C(C)=C)C(C)(CC1)C=C |
| CAS ID | 20307-84-0 |
| PubChem ID | 12309449 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Delta-elemene, also known as δ-elemene, is a member of the class of compounds known as sesquiterpenoids. Sesquiterpenoids are terpenes with three consecutive isoprene units. Delta-elemene is a woody tasting compound found in anise, guava, mandarin orange (clementine, tangerine), and pepper (spice), which makes delta-elemene a potential biomarker for the consumption of these food products. |
|---|