alpha-thujene; 3-thujene; (+/-)-alpha-thujene
| Name(s) | alpha-thujene; 3-thujene; (+/-)-alpha-thujene |
|---|---|
| Scientific name(s) | 3-thujene; 2867-05-2; origanene; bicyclo[3.1.0]hex-2-ene, 2-methyl-5-(1-methylethyl)-; 2-methyl-5-propan-2-ylbicyclo[3.1.0]hex-2-ene; 5-isopropyl-2-methylbicyclo[3.1.0]hex-2-ene; 2-methyl-5-(1-methylethyl)-bicyclo(3.1.0)hex-2-ene |
| Formula | C10H16 |
| Molecular mass | 136.238 |
| IUPAC name | 2-methyl-5-propan-2-ylbicyclo[3.1.0]hex-2-ene |
| INCHI | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h4,7,9H,5-6H2,1-3H3 |
| SMILE | CC(C)C12CC1C(C)=CC2 |
| CAS ID | 67-05-2; 3917-48-4 |
| PubChem ID | 17868 |
| DrugBank ID | Not available |
| CHEBI ID | 50031 |
| Description | Xi-3-thujene, also known as alpha-thujen or 5-isopropyl-2-methylbicyclo[3.1.0]hex-2-ene, is a member of the class of compounds known as bicyclic monoterpenoids. Bicyclic monoterpenoids are monoterpenoids containing exactly 2 rings, which are fused to each other. Xi-3-thujene can be found in herbs and spices, which makes xi-3-thujene a potential biomarker for the consumption of this food product. |
|---|