(e)-nerolidol; e-nerolidol; trans-nerolidol; nerolidol; (±)-trans-nerolidol; 1,6,10-dodecatrien-3-ol, 3,7,11-trimethyl-, (e)-
| Name(s) | (e)-nerolidol; e-nerolidol; trans-nerolidol; nerolidol; (±)-trans-nerolidol; 1,6,10-dodecatrien-3-ol, 3,7,11-trimethyl-, (e)- |
|---|---|
| Scientific name(s) | nerolidol; 7212-44-4; trans-nerolidol; 40716-66-3; 3,7,11-trimethyldodeca-1,6,10-trien-3-ol; (6e)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol; (e)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol; 3,7,11-trimethyl-1,6,10-dodecatrien-3-ol |
| Formula | C15H26O |
| Molecular mass | 222.372 |
| IUPAC name | (6e)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| INCHI | Not available |
| SMILE | CC(C)=CCCC(C)=CCCC(C)(O)C=C |
| CAS ID | 7212-44-4; 40716-66-3 |
| PubChem ID | 5284507 |
| DrugBank ID | Not available |
| CHEBI ID | 7524 |
| Description | A component of many essential oils. The (S)-enantiomer is the commoner and occurs mostly as the (S)-(E)-isomer. Flavouring agent. Nerolidol is found in many foods, some of which are coriander, sweet basil, roman camomile, and sweet orange. |
|---|