methyleugenol; methyl eugenol; benzene, 1,2-dimethoxy-4-(2-propenyl)-; eugenol methyl ether
| Name(s) | methyleugenol; methyl eugenol; benzene, 1,2-dimethoxy-4-(2-propenyl)-; eugenol methyl ether |
|---|---|
| Scientific name(s) | methyleugenol; 93-15-2; 4-allyl-1,2-dimethoxybenzene; eugenol methyl ether; 4-allylveratrole; o-methyleugenol; eugenyl methyl ether; methyl eugenol |
| Formula | C11H14O2 |
| Molecular mass | 178.231 |
| IUPAC name | 1,2-dimethoxy-4-prop-2-enylbenzene |
| INCHI | InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3 |
| SMILE | COC1=C(OC)C=C(CC=C)C=C1 |
| CAS ID | 93-15-2; 97-53-0 |
| PubChem ID | 7127 |
| DrugBank ID | Not available |
| CHEBI ID | 4918 |
| Description | Present in many essential oils, e.g. nutmeg, mace and also many fruits, e.g. apple, banana, orange juice or peel, grapefruit, bilberry. Methyleugenol is found in many foods, some of which are wild carrot, sweet basil, citrus, and fruits. |
|---|