citral; ( e)-citral; geranial; (e)-citral; 2,6-octadienal, 3,7-dimethyl-, (e)-
| Name(s) | citral; ( e)-citral; geranial; (e)-citral; 2,6-octadienal, 3,7-dimethyl-, (e)- |
|---|---|
| Scientific name(s) | geranial |
| Formula | C10H16O |
| Molecular mass | 152.237 |
| IUPAC name | (2e)-3,7-dimethylocta-2,6-dienal |
| INCHI | InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7+ |
| SMILE | CC(C)=CCC\C(C)=C\C=O |
| CAS ID | 5392-40-5; 141-27-5 |
| PubChem ID | 638011 |
| DrugBank ID | Not available |
| CHEBI ID | 16980 |
| Description | Occurs in lemon grass oil (Cymbopogon citratus), lemon, orange and many other essential oils; flavouring ingredient. Geranial is found in many foods, some of which are watermelon, nutmeg, cloud ear fungus, and yellow wax bean. |
|---|