d-limonene; (r)-limonene
| Name(s) | d-limonene; (r)-limonene |
|---|---|
| Scientific name(s) | (r)-(+)-limonene; (+)-limonene; (d)-limonene |
| Formula | C10H16 |
| Molecular mass | 136.238 |
| IUPAC name | (4r)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| INCHI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| SMILE | CC(=C)[C@@H]1CCC(C)=CC1 |
| CAS ID | 5989-27-5 |
| PubChem ID | 440917 |
| DrugBank ID | Not available |
| CHEBI ID | 15382 |
| Description | Major constituent of oil of orange rind, dill oil, oil of cumin, bergamot, caraway, lemon balm and lemon. obtained comly. from orange oil on a large scale (ca. 50000 T/a). Flavouring agent. Nutriceutical with anticancer props. (R)-Limonene is found in many foods, some of which are citrus, nutmeg, guava, and cardamom. |
|---|