l-threonine; threonine
| Name(s) | l-threonine; threonine |
|---|---|
| Scientific name(s) | threonine; 72-19-5; (2s,3r)-2-amino-3-hydroxybutanoic acid; l-(-)-threonine; threonin; (s)-threonine; dl-threonine |
| Formula | C4H9NO3 |
| Molecular mass | 119.12 |
| IUPAC name | (2s,3r)-2-amino-3-hydroxybutanoic acid |
| INCHI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1 |
| SMILE | C[C@@H](O)[C@H](N)C(O)=O |
| CAS ID | l-72-19-5；d-632-20-2; 72-19-5; 80-68-2; l-72-19-5; d-632-20-2 |
| PubChem ID | 6288 |
| DrugBank ID | DB00156 |
| CHEBI ID | 16857 |
| Description | From wide variety of protein hydrolysates. Dietary supplement, nutrient_x000D_ _x000D_ Threonine (abbreviated as Thr or T) is an essential alpha-amino acid. L-Threonine is found in many foods, some of which are roe, american butterfish, root vegetables, and jicama. |
|---|