l-leucine; leucine
| Name(s) | l-leucine; leucine |
|---|---|
| Scientific name(s) | |
| Formula | C6H13NO2 |
| Molecular mass | 131.175 |
| IUPAC name | (2s)-2-amino-4-methylpentanoic acid |
| INCHI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| SMILE | CC(C)CC(N)C(O)=O |
| CAS ID | l-61-90-5; d-328-38-1; 61-90-5; 3588-60-1 |
| PubChem ID | 6106 |
| DrugBank ID | DB01746 |
| CHEBI ID | Not available |
| Description | Flavouring ingredient; dietary supplement, nutrient. L-Leucine is found in many foods, some of which are lettuce, common bean, pacific herring, and kefir. |
|---|