| Name(s) | l-tyrosine; tyrosine |
|---|---|
| Scientific name(s) | |
| Formula | C9H11NO3 |
| Molecular mass | 181.191 |
| IUPAC name | 2-amino-3-(4-hydroxyphenyl)propanoic acid |
| INCHI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
| SMILE | NC(CC1=CC=C(O)C=C1)C(O)=O |
| CAS ID | l-60-18-4; 60-18-4 |
| PubChem ID | 6057 |
| DrugBank ID | DB03839 |
| CHEBI ID | 17895 |
| Description | Dietary supplement, nutrient. Flavouring ingredient. L-Tyrosine is found in many foods, some of which are blue crab, sweet rowanberry, lemon sole, and alpine sweetvetch. |
|---|