| Name(s) | ergosterol |
|---|---|
| Scientific name(s) | (22e)-ergosta-5,7,22-trien-3β-ol; ergosta-5,7,22-trien |
| Formula | C28H44O |
| Molecular mass | 396.659 |
| IUPAC name | (22E)-Ergosta-5,7,22-trien-3β-ol |
| INCHI | InChI=1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18-20,22,24-26,29H,11-17H2,1-6H3/b8-7+ |
| SMILE | CC(C)C(C)\C=C\C(C)C1CCC2C3=CC=C4CC(O)CCC4(C)C3CCC12C |
| CAS ID | 57-87-4 |
| PubChem ID | 444679 |
| DrugBank ID | DB04038 |
| CHEBI ID | 16933 |
| Description | Indicator of fungal contamination, especies in cereals. Occurs in yeast and fungi. The main fungal steroidand is also found in small amts. in higher plant prods., e.g. palm oil [DFC]. |
|---|