l-arginine; arginine
| Name(s) | l-arginine; arginine |
|---|---|
| Scientific name(s) | |
| Formula | C6H14N4O2 |
| Molecular mass | 174.2 |
| IUPAC name | (2s)-2-amino-5-carbamimidamidopentanoic acid |
| INCHI | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 |
| SMILE | N[C@@H](CCCNC(N)=N)C(O)=O |
| CAS ID | 74-79-3; l-74-79-3; d-157-06-2 |
| PubChem ID | 6322 |
| DrugBank ID | DB00125 |
| CHEBI ID | 16467 |
| Description | Dietary supplement, nutrient_x000D_ _x000D_ Arginine (abbreviated as Arg or R) is an alpha-amino acid. The L-form is one of the 20 most common natural amino acids. Arginine is found in many foods, some of which are pulses, flaxseed, yellow wax bean, and crab. |
|---|