apigenin
| Name(s) | apigenin |
|---|---|
| Scientific name(s) | 5,7-dihydroxy-2-(4-hydroxyphenyl)-4h-chromen-4-one; chamomile; versulin; apigenol; 4',5,7-trihydroxyflavone; spigenin; 5,7, 4'-trihydroxyflavone |
| Formula | C15H10O5 |
| Molecular mass | 270.24 |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| INCHI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H |
| SMILE | OC1=CC=C(C=C1)C1=CC(=O)C2=C(O)C=C(O)C=C2O1 |
| CAS ID | 520-36-5 |
| PubChem ID | 5280443 |
| DrugBank ID | DB07352 |
| CHEBI ID | Not available |
| Description | Flavone found in a wide variety of foodstuffs; buckwheat, cabbage, celeriac, celery, lettuce, oregano, parsley, peppermint, perilla, pummelo juice, thyme, sweet potatoes, green tea and wild carrot [DFC] |
|---|