| Name(s) | p-coumaric acid; 4-hydroxycinnamic acid; hydroxycinnamic acid; 4-hydroxy cinnamic acid |
|---|---|
| Scientific name(s) | p-coumaric acid; p-hydroxycinnamic acid; 4-coumaric acid; trans-4-hydroxycinnamic acid; 7400-08-0; trans-p-coumaric acid; 4-hydroxycinnamic acid |
| Formula | C9H8O3 |
| Molecular mass | 164.16 |
| IUPAC name | (e)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| INCHI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
| SMILE | OC(=O)\C=C\C1=CC=C(O)C=C1 |
| CAS ID | 7400-08-0; 501-98-4 |
| PubChem ID | 637542 |
| DrugBank ID | DB04066 |
| CHEBI ID | Not available |
| Description | Coumaric acid is a hydroxycinnamic acid, an organic compound that is a hydroxy derivative of cinnamic acid. There are three isomers, o-coumaric acid, m-coumaric acid, and p-coumaric acid, that differ by the position of the hydroxy substitution of the phenyl group. p-Coumaric acid is the most abundant isomer of the three in nature. p-Coumaric acid is found in many foods, some of which are garden onion, turmeric, green bell pepper, and common thyme. |
|---|