| Name(s) | tetradecoic acid; tetradecanoic acid; myristic acid |
|---|---|
| Scientific name(s) | myristic acid; n-tetradecanoic acid; crodacid; n-tetradecoic acid; n-tetradecan-1-oic acid; 1-tridecanecarboxylic acid; tetradecanoic acid |
| Formula | C14H28O2 |
| Molecular mass | 228.376 |
| IUPAC name | tetradecanoic acid |
| INCHI | InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16) |
| SMILE | CCCCCCCCCCCCCC(O)=O |
| CAS ID | 544-63-8 |
| PubChem ID | 11005 |
| DrugBank ID | DB08231 |
| CHEBI ID | 28875 |
| Description | Occurs widely in vegetable glycerides. Major component of the lipids of nutmeg (Myristica moschata). Defoaming agent, lubricant used in food processing_x000D_ _x000D_ Myristic acid, also called tetradecanoic acid, is a common saturated fatty acid with the molecular formula CH3(CH2)12COOH. Besides nutmeg, myristic acid is also found in palm kernel oil, coconut oil, butter fat and is a minor component of many other animal fats. |
|---|