3-octanol; (s)-3-octanol
| Name(s) | 3-octanol; (s)-3-octanol |
|---|---|
| Scientific name(s) | 3-octanol; octan-3-ol; amyl ethyl carbinol; octanol-3; ethyl-n-amylcarbinol; amylethylcarbinol |
| Formula | C8H18O |
| Molecular mass | 130.231 |
| IUPAC name | octan-3-ol |
| INCHI | InChI=1S/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3 |
| SMILE | CCCCCC(O)CC |
| CAS ID | 20296-29-1; 589-98-0; 22658-92-0 |
| PubChem ID | 11527 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Present in Mentha subspecies oils, sage, soybeans, porcini (Boletus edulis), wines and other foodstuffs. Flavouring agent. 3-Octanol is found in many foods, some of which are mushrooms, soy bean, rosemary, and alcoholic beverages. |
|---|