methionine; l-methionine
| Name(s) | methionine; l-methionine |
|---|---|
| Scientific name(s) | l-methionine; (s)-2-amino-4-(methylthio)butanoic acid; h-met-oh; cymethion; ; methionine; l-(-)-methionine; s-methionine |
| Formula | C5H11NO2S |
| Molecular mass | 149.208 |
| IUPAC name | (2S)-2-amino-4-methylsulfanylbutanoic acid; 2-amino-4-(methylthio)butanoic acid |
| INCHI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| SMILE | CSCC[C@H](N)C(O)=O |
| CAS ID | 63-68-3; 59-51-8; l-63-68-3; d-348-67-4; l-63-68-3；d-348-67-4 |
| PubChem ID | 6137 |
| DrugBank ID | DB00134 |
| CHEBI ID | 16643 |
| Description | Dietary supplement and nutrient_x000D_ _x000D_ Methionine is an alpha-amino acid with the chemical formula HO2CCH(NH2)CH2CH2SCH3. This essential amino acid is classified as nonpolar. L-Methionine is found in many foods, some of which are broad bean, atlantic cod, celeriac, and rowal. |
|---|