thiamine
| Name(s) | thiamine |
|---|---|
| Scientific name(s) | thiamin; vitamin b1; aneurin; antiberiberi factor; thiamine ion; thiadoxine; betaxin |
| Formula | C12H17N4OS+ |
| Molecular mass | 265.36 |
| IUPAC name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol |
| INCHI | InChI=1S/C12H17N4OS/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15)/q+1 |
| SMILE | CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N |
| CAS ID | 70-16-6 |
| PubChem ID | 1130 |
| DrugBank ID | Not available |
| CHEBI ID | 18385 |
| Description | Thiamine is an essential vitamin. It is found in many foods, some of which are atlantic croaker, wonton wrapper, cereals and cereal products, and turmeric. |
|---|