scopoletin
| Name(s) | scopoletin |
|---|---|
| Scientific name(s) | 6-methoxy-7-hydroxycoumarin; chrysatroic acid; baogongteng b; 6-methoxy-7-hydroxycoumarin/chrysatroic acid/baogongteng b; 6-methoxy- |
| Formula | C10H8O4 |
| Molecular mass | 192.17 |
| IUPAC name | 7-hydroxy-6-methoxy-2h-chromen-2-one |
| INCHI | InChI=1S/C10H8O4/c1-13-9-4-6-2-3-10(12)14-8(6)5-7(9)11/h2-5,11H,1H3 |
| SMILE | COC1=C(O)C=C2OC(=O)C=CC2=C1 |
| CAS ID | 92-61-5 |
| PubChem ID | 5280460 |
| DrugBank ID | Not available |
| CHEBI ID | 17488 |
| Description | Isolated from Angelica acutiloba (Dong Dang Gui). Scopoletin is found in many foods, some of which are lambsquarters, lemon, sunflower, and sherry. |
|---|