stigmasterol
| Name(s) | stigmasterol |
|---|---|
| Scientific name(s) | (22e)-stigmasta-5,22-dien-3β-ol |
| Formula | C29H48O |
| Molecular mass | 412.702 |
| IUPAC name | （22E）-Stigmasta-5,22-dien-3β-ol |
| INCHI | InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-10,19-21,23-27,30H,7,11-18H2,1-6H3/b9-8+/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)\C=C\[C@@H](CC)C(C)C |
| CAS ID | 83-48-7 |
| PubChem ID | 5280794 |
| DrugBank ID | Not available |
| CHEBI ID | 28824 |
| Description | Stigmasterol is an unsaturated plant sterol occurring in the plant fats or oils of soybean, calabar bean, and rape seed, and in a number of medicinal herbs, including the Chinese herbs Ophiopogon japonicus (Mai men dong) and American Ginseng. Stigmasterol is also found in various vegetables, legumes, nuts, seeds, and unpasteurized milk. |
|---|