FoodTCM

γ-aminobutyric acid; gamma-aminobutyric acid; 4-aminobutyric acid; gaba

Name(s)	γ-aminobutyric acid; gamma-aminobutyric acid; 4-aminobutyric acid; gaba
Scientific name(s)	y-aminobutyric acid; 4-aminobutanoic acid; gamma-aminobutyric acid; gaba; piperidic acid; piperidinic acid; aminalon; 56-12-2
Formula	C4H9NO2
Molecular mass	103.121
IUPAC name	4-aminobutanoic acid
INCHI	InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)
SMILE	NCCCC(O)=O
CAS ID	56-12-2
PubChem ID	119
DrugBank ID	DB02530
CHEBI ID	16865

Description	Gamma-Aminobutyric acid is the chief inhibitory neurotransmitter in the mammalian central nervous system. It plays a role in regulating neuronal excitability throughout the nervous system. In humans, GABA is also directly responsible for the regulation of muscle tone. [Wikipedia]. 4-Aminobutyric acid is found in many foods, some of which are hard wheat, fenugreek, hickory nut, and arctic blackberry.

Description

Gamma-Aminobutyric acid is the chief inhibitory neurotransmitter in the mammalian central nervous system. It plays a role in regulating neuronal excitability throughout the nervous system. In humans, GABA is also directly responsible for the regulation of muscle tone. [Wikipedia]. 4-Aminobutyric acid is found in many foods, some of which are hard wheat, fenugreek, hickory nut, and arctic blackberry.